C8H5F3N2O3 — CID 63644130
6-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylic acid (PubChem CID 63644130) has the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 6-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63644130 |
| Molecular Formula | C8H5F3N2O3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 6-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5F3N2O3/c9-8(10,11)7(16)13-5-3-1-2-4(12-5)6(14)15/h1-3H,(H,14,15)(H,12,13,16) |
| InChIKey | VMUHLQSWTWKYHR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |