C11H15N3O2 — CID 90865597
2,2-dimethyl-N-[6-(nitrosomethyl)-2-pyridinyl]propanamide (PubChem CID 90865597) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2,2-dimethyl-N-[6-(nitrosomethyl)-2-pyridinyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[6-(nitrosomethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90865597 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2,2-dimethyl-N-[6-(nitrosomethyl)-2-pyridinyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(CN=O)n1 |
| InChI | InChI=1S/C11H15N3O2/c1-11(2,3)10(15)14-9-6-4-5-8(13-9)7-12-16/h4-6H,7H2,1-3H3,(H,13,14,15) |
| InChIKey | BNYBQODNIIWTHU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |