C12H17ClN2O — CID 59272532
N-(6-chloro-5-ethyl-2-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 59272532) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is N-(6-chloro-5-ethyl-2-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-chloro-5-ethyl-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 59272532 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-(6-chloro-5-ethyl-2-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CCc1ccc(NC(=O)C(C)(C)C)nc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c1-5-8-6-7-9(14-10(8)13)15-11(16)12(2,3)4/h6-7H,5H2,1-4H3,(H,14,15,16) |
| InChIKey | DHBCIHBKYZTMPY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|