C21H28N4O2 — CID 143998085
2,2-dimethyl-N-[6-[3-[(3-methylphenyl)carbamoylamino]propyl]-2-pyridinyl]propanamide (PubChem CID 143998085) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2,2-dimethyl-N-[6-[3-[(3-methylphenyl)carbamoylamino]propyl]-2-pyridinyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[6-[3-[(3-methylphenyl)carbamoylamino]propyl]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 143998085 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2,2-dimethyl-N-[6-[3-[(3-methylphenyl)carbamoylamino]propyl]-2-pyridinyl]propanamide |
| SMILES | Cc1cccc(NC(=O)NCCCc2cccc(NC(=O)C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-15-8-5-10-17(14-15)24-20(27)22-13-7-11-16-9-6-12-18(23-16)25-19(26)21(2,3)4/h5-6,8-10,12,14H,7,11,13H2,1-4H3,(H2,22,24,27)(H,23,25,26) |
| InChIKey | QCLBQRDPXYNUHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|