C11H17N3O3S — CID 61132641
1-(3-methylphenyl)-3-(3-sulfamoylpropyl)urea (PubChem CID 61132641) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(3-sulfamoylpropyl)urea.
| Compound Name | 1-(3-methylphenyl)-3-(3-sulfamoylpropyl)urea |
|---|---|
| PubChem CID | 61132641 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(3-methylphenyl)-3-(3-sulfamoylpropyl)urea |
| SMILES | Cc1cccc(NC(=O)NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O3S/c1-9-4-2-5-10(8-9)14-11(15)13-6-3-7-18(12,16)17/h2,4-5,8H,3,6-7H2,1H3,(H2,12,16,17)(H2,13,14,15) |
| InChIKey | FDBCXSZMLZCKRN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|