C21H27FN4O3 — CID 90690209
3-methylpentan-3-yl N-[6-[2-[(3-fluorophenyl)carbamoylamino]ethyl]-2-pyridinyl]carbamate (PubChem CID 90690209) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-methylpentan-3-yl N-[6-[2-[(3-fluorophenyl)carbamoylamino]ethyl]-2-pyridinyl]carbamate.
| Compound Name | 3-methylpentan-3-yl N-[6-[2-[(3-fluorophenyl)carbamoylamino]ethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 90690209 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-methylpentan-3-yl N-[6-[2-[(3-fluorophenyl)carbamoylamino]ethyl]-2-pyridinyl]carbamate |
| SMILES | CCC(C)(CC)OC(=O)Nc1cccc(CCNC(=O)Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H27FN4O3/c1-4-21(3,5-2)29-20(28)26-18-11-7-9-16(24-18)12-13-23-19(27)25-17-10-6-8-15(22)14-17/h6-11,14H,4-5,12-13H2,1-3H3,(H2,23,25,27)(H,24,26,28) |
| InChIKey | FNPIMJKCKHDTGU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |