About N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide
N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide (PubChem CID 59013576) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide.
Molecular Properties
| Compound Name | N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide |
| PubChem CID | 59013576 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(/C=[N+](\[O-])C(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O2/c1-14(2,3)13(19)17-12-9-7-8-11(16-12)10-18(20)15(4,5)6/h7-10H,1-6H3,(H,16,17,19)/b18-10- |
| InChIKey | HGTWCAXVEUMUAG-ZDLGFXPLSA-N |
| XLogP | 2.79 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide?
The IUPAC name of N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide (CID 59013576) is N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide.
What is the SMILES notation for N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide?
The canonical SMILES for N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide is CC(C)(C)C(=O)Nc1cccc(/C=[N+](\[O-])C(C)(C)C)n1.
What is the InChIKey of N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide?
The InChIKey is HGTWCAXVEUMUAG-ZDLGFXPLSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-14(2,3)13(19)17-12-9-7-8-11(16-12)10-18(20)15(4,5)6/h7-10H,1-6H3,(H,16,17,19)/b18-10-.
What are the key properties of N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide?
N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide has a molecular weight of 277.37 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide is sourced from PubChem (CID 59013576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).