C15H23N3O2 — CID 59013576
N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide (PubChem CID 59013576) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide.
| Compound Name | N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide |
|---|---|
| PubChem CID | 59013576 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-tert-butyl-1-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]methanimine oxide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(/C=[N+](\[O-])C(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O2/c1-14(2,3)13(19)17-12-9-7-8-11(16-12)10-18(20)15(4,5)6/h7-10H,1-6H3,(H,16,17,19)/b18-10- |
| InChIKey | HGTWCAXVEUMUAG-ZDLGFXPLSA-N |
| XLogP | 2.79 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|