C23H25N2OP — CID 102181081
2,2-dimethyl-N-[6-[(2-methylphenyl)-phenylphosphanyl]-2-pyridinyl]propanamide (PubChem CID 102181081) has the molecular formula C23H25N2OP and a molecular weight of 376.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-[6-[(2-methylphenyl)-phenylphosphanyl]-2-pyridinyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[6-[(2-methylphenyl)-phenylphosphanyl]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 102181081 |
| Molecular Formula | C23H25N2OP |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2,2-dimethyl-N-[6-[(2-methylphenyl)-phenylphosphanyl]-2-pyridinyl]propanamide |
| SMILES | Cc1ccccc1P(c1ccccc1)c1cccc(NC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C23H25N2OP/c1-17-11-8-9-14-19(17)27(18-12-6-5-7-13-18)21-16-10-15-20(24-21)25-22(26)23(2,3)4/h5-16H,1-4H3,(H,24,25,26) |
| InChIKey | VJGWKYGLSWFKAQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|