C19H21N3O2 — CID 102139348
N-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]-4-ethenylbenzamide (PubChem CID 102139348) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]-4-ethenylbenzamide.
| Compound Name | N-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]-4-ethenylbenzamide |
|---|---|
| PubChem CID | 102139348 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[6-(2,2-dimethylpropanoylamino)-2-pyridinyl]-4-ethenylbenzamide |
| SMILES | C=Cc1ccc(C(=O)Nc2cccc(NC(=O)C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-5-13-9-11-14(12-10-13)17(23)21-15-7-6-8-16(20-15)22-18(24)19(2,3)4/h5-12H,1H2,2-4H3,(H2,20,21,22,23,24) |
| InChIKey | MDKMCBVNITYKQW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |