C15H21Cl2N3O2 — CID 2767546
3-chloro-N-[6-[(3-chloro-2,2-dimethylpropanoyl)amino]-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 2767546) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 3-chloro-N-[6-[(3-chloro-2,2-dimethylpropanoyl)amino]-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[6-[(3-chloro-2,2-dimethylpropanoyl)amino]-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2767546 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-chloro-N-[6-[(3-chloro-2,2-dimethylpropanoyl)amino]-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cccc(NC(=O)C(C)(C)CCl)n1 |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-14(2,8-16)12(21)19-10-6-5-7-11(18-10)20-13(22)15(3,4)9-17/h5-7H,8-9H2,1-4H3,(H2,18,19,20,21,22) |
| InChIKey | VRZTVZBTJUBGJO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|