C23H25N2O2P — CID 102181078
N-[6-[(2-methoxyphenyl)-phenylphosphanyl]-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 102181078) has the molecular formula C23H25N2O2P and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[6-[(2-methoxyphenyl)-phenylphosphanyl]-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | N-[6-[(2-methoxyphenyl)-phenylphosphanyl]-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 102181078 |
| Molecular Formula | C23H25N2O2P |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[6-[(2-methoxyphenyl)-phenylphosphanyl]-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccccc1P(c1ccccc1)c1cccc(NC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C23H25N2O2P/c1-23(2,3)22(26)25-20-15-10-16-21(24-20)28(17-11-6-5-7-12-17)19-14-9-8-13-18(19)27-4/h5-16H,1-4H3,(H,24,25,26) |
| InChIKey | QZSLJYODDDUCPW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|