C21H24BNO3P — CID 57341193
CID 57341193 (PubChem CID 57341193) has the molecular formula C21H24BNO3P and a molecular weight of 380.21 g/mol.
| Compound Name | CID 57341193 |
|---|---|
| PubChem CID | 57341193 |
| Molecular Formula | C21H24BNO3P |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | — |
| SMILES | COC(=O)N1CCCCC=C1P(c1ccccc1)c1ccccc1OC.[B] |
| InChI | InChI=1S/C21H24NO3P.B/c1-24-18-13-8-9-14-19(18)26(17-11-5-3-6-12-17)20-15-7-4-10-16-22(20)21(23)25-2;/h3,5-6,8-9,11-15H,4,7,10,16H2,1-2H3; |
| InChIKey | UKWMBQXPPIKUND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|