C13H16NO3- — CID 102356680
2-(2,2-dimethylpropanoylamino)-6-methylbenzoate (PubChem CID 102356680) has the molecular formula C13H16NO3- and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-6-methylbenzoate.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-6-methylbenzoate |
|---|---|
| PubChem CID | 102356680 |
| Molecular Formula | C13H16NO3- |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-6-methylbenzoate |
| SMILES | Cc1cccc(NC(=O)C(C)(C)C)c1C(=O)[O-] |
| InChI | InChI=1S/C13H17NO3/c1-8-6-5-7-9(10(8)11(15)16)14-12(17)13(2,3)4/h5-7H,1-4H3,(H,14,17)(H,15,16)/p-1 |
| InChIKey | JZRLLLULSVYCSF-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |