C15H21NO3S — CID 134095661
2-(2,2-dimethylpropanoylamino)-6-propan-2-ylsulfanylbenzoic acid (PubChem CID 134095661) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-6-propan-2-ylsulfanylbenzoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-6-propan-2-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 134095661 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-6-propan-2-ylsulfanylbenzoic acid |
| SMILES | CC(C)Sc1cccc(NC(=O)C(C)(C)C)c1C(=O)O |
| InChI | InChI=1S/C15H21NO3S/c1-9(2)20-11-8-6-7-10(12(11)13(17)18)16-14(19)15(3,4)5/h6-9H,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | CMDYAKXMDKSOGG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |