C32H33NOS2 — CID 102447743
N-[2,3-bis(propan-2-ylsulfanyl)phenyl]-2,2,2-triphenylacetamide (PubChem CID 102447743) has the molecular formula C32H33NOS2 and a molecular weight of 511.76 g/mol. Its IUPAC name is N-[2,3-bis(propan-2-ylsulfanyl)phenyl]-2,2,2-triphenylacetamide.
| Compound Name | N-[2,3-bis(propan-2-ylsulfanyl)phenyl]-2,2,2-triphenylacetamide |
|---|---|
| PubChem CID | 102447743 |
| Molecular Formula | C32H33NOS2 |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-[2,3-bis(propan-2-ylsulfanyl)phenyl]-2,2,2-triphenylacetamide |
| SMILES | CC(C)Sc1cccc(NC(=O)C(c2ccccc2)(c2ccccc2)c2ccccc2)c1SC(C)C |
| InChI | InChI=1S/C32H33NOS2/c1-23(2)35-29-22-14-21-28(30(29)36-24(3)4)33-31(34)32(25-15-8-5-9-16-25,26-17-10-6-11-18-26)27-19-12-7-13-20-27/h5-24H,1-4H3,(H,33,34) |
| InChIKey | OHCYEHUKMVQJAO-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|