C24H26S2 — CID 101475089
1-(4-phenylphenyl)-2,3-bis(propan-2-ylsulfanyl)benzene (PubChem CID 101475089) has the molecular formula C24H26S2 and a molecular weight of 378.61 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-2,3-bis(propan-2-ylsulfanyl)benzene.
| Compound Name | 1-(4-phenylphenyl)-2,3-bis(propan-2-ylsulfanyl)benzene |
|---|---|
| PubChem CID | 101475089 |
| Molecular Formula | C24H26S2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-(4-phenylphenyl)-2,3-bis(propan-2-ylsulfanyl)benzene |
| SMILES | CC(C)Sc1cccc(-c2ccc(-c3ccccc3)cc2)c1SC(C)C |
| InChI | InChI=1S/C24H26S2/c1-17(2)25-23-12-8-11-22(24(23)26-18(3)4)21-15-13-20(14-16-21)19-9-6-5-7-10-19/h5-18H,1-4H3 |
| InChIKey | GCIYOIHDZJILJM-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |