C25H26OS — CID 144561383
S-(2,6-diphenylphenyl) 2,3,3-trimethylbutanethioate (PubChem CID 144561383) has the molecular formula C25H26OS and a molecular weight of 374.55 g/mol. Its IUPAC name is S-(2,6-diphenylphenyl) 2,3,3-trimethylbutanethioate.
| Compound Name | S-(2,6-diphenylphenyl) 2,3,3-trimethylbutanethioate |
|---|---|
| PubChem CID | 144561383 |
| Molecular Formula | C25H26OS |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | S-(2,6-diphenylphenyl) 2,3,3-trimethylbutanethioate |
| SMILES | CC(C(=O)Sc1c(-c2ccccc2)cccc1-c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H26OS/c1-18(25(2,3)4)24(26)27-23-21(19-12-7-5-8-13-19)16-11-17-22(23)20-14-9-6-10-15-20/h5-18H,1-4H3 |
| InChIKey | LWDIDGDIMRZRMA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|