C28H34O2S — CID 144560631
S-[2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenylphenoxy]ethyl] 2,3,3-trimethylbutanethioate (PubChem CID 144560631) has the molecular formula C28H34O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is S-[2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenylphenoxy]ethyl] 2,3,3-trimethylbutanethioate.
| Compound Name | S-[2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenylphenoxy]ethyl] 2,3,3-trimethylbutanethioate |
|---|---|
| PubChem CID | 144560631 |
| Molecular Formula | C28H34O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | S-[2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenylphenoxy]ethyl] 2,3,3-trimethylbutanethioate |
| SMILES | C=C/C=C\C(=C/C)c1cccc(-c2ccccc2)c1OCCSC(=O)C(C)C(C)(C)C |
| InChI | InChI=1S/C28H34O2S/c1-7-9-14-22(8-2)24-17-13-18-25(23-15-11-10-12-16-23)26(24)30-19-20-31-27(29)21(3)28(4,5)6/h7-18,21H,1,19-20H2,2-6H3/b14-9-,22-8+ |
| InChIKey | HQUNMRPJQZXCQE-XIHCONSMSA-N |
| XLogP | 7.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|