C19H26O3 — CID 143785797
ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoic acid;methoxyethene (PubChem CID 143785797) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoic acid;methoxyethene.
| Compound Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoic acid;methoxyethene |
|---|---|
| PubChem CID | 143785797 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoic acid;methoxyethene |
| SMILES | C=C/C=C\C(=C/C)c1cccc(C(=O)O)c1.C=COC.CC |
| InChI | InChI=1S/C14H14O2.C3H6O.C2H6/c1-3-5-7-11(4-2)12-8-6-9-13(10-12)14(15)16;1-3-4-2;1-2/h3-10H,1H2,2H3,(H,15,16);3H,1H2,2H3;1-2H3/b7-5-,11-4+;; |
| InChIKey | VICVWFJHAJRJEA-RRVAGDDNSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|