C19H14F4S — CID 171927851
(2,3-diphenylphenyl) thiohypofluorite;fluoroform (PubChem CID 171927851) has the molecular formula C19H14F4S and a molecular weight of 350.38 g/mol. Its IUPAC name is (2,3-diphenylphenyl) thiohypofluorite;fluoroform.
| Compound Name | (2,3-diphenylphenyl) thiohypofluorite;fluoroform |
|---|---|
| PubChem CID | 171927851 |
| Molecular Formula | C19H14F4S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2,3-diphenylphenyl) thiohypofluorite;fluoroform |
| SMILES | FC(F)F.FSc1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H13FS.CHF3/c19-20-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;2-1(3)4/h1-13H;1H |
| InChIKey | ZKCUMDVZIBGRCC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |