C18H13FS — CID 151424182
(2,3-diphenylphenyl) thiohypofluorite (PubChem CID 151424182) has the molecular formula C18H13FS and a molecular weight of 280.37 g/mol. Its IUPAC name is (2,3-diphenylphenyl) thiohypofluorite.
| Compound Name | (2,3-diphenylphenyl) thiohypofluorite |
|---|---|
| PubChem CID | 151424182 |
| Molecular Formula | C18H13FS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2,3-diphenylphenyl) thiohypofluorite |
| SMILES | FSc1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H13FS/c19-20-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15/h1-13H |
| InChIKey | PBEBCNIPHCWCRM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |