About lithium;hydride;1-methyl-2,3-diphenylbenzene
lithium;hydride;1-methyl-2,3-diphenylbenzene (PubChem CID 175388205) has the molecular formula C19H17Li
and a molecular weight of 252.29 g/mol. Its IUPAC name is lithium;hydride;1-methyl-2,3-diphenylbenzene.
Molecular Properties
| Compound Name | lithium;hydride;1-methyl-2,3-diphenylbenzene |
| PubChem CID | 175388205 |
| Molecular Formula | C19H17Li |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | lithium;hydride;1-methyl-2,3-diphenylbenzene |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C19H16.Li.H/c1-15-9-8-14-18(16-10-4-2-5-11-16)19(15)17-12-6-3-7-13-17;;/h2-14H,1H3;;/q;+1;-1 |
| InChIKey | HALAJDLANZFNCA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;hydride;1-methyl-2,3-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1-methyl-2,3-diphenylbenzene?
The IUPAC name of lithium;hydride;1-methyl-2,3-diphenylbenzene (CID 175388205) is lithium;hydride;1-methyl-2,3-diphenylbenzene.
What is the SMILES notation for lithium;hydride;1-methyl-2,3-diphenylbenzene?
The canonical SMILES for lithium;hydride;1-methyl-2,3-diphenylbenzene is Cc1cccc(-c2ccccc2)c1-c1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;1-methyl-2,3-diphenylbenzene?
The InChIKey is HALAJDLANZFNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.Li.H/c1-15-9-8-14-18(16-10-4-2-5-11-16)19(15)17-12-6-3-7-13-17;;/h2-14H,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;1-methyl-2,3-diphenylbenzene?
lithium;hydride;1-methyl-2,3-diphenylbenzene has a molecular weight of 252.29 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1-methyl-2,3-diphenylbenzene is sourced from PubChem (CID 175388205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).