C28H31NO3Si2 — CID 101224817
methyl 2-[2-[2-acetamido-5-(2-trimethylsilylethynyl)phenyl]ethynyl]-4-(2-trimethylsilylethynyl)benzoate (PubChem CID 101224817) has the molecular formula C28H31NO3Si2 and a molecular weight of 485.73 g/mol. Its IUPAC name is methyl 2-[2-[2-acetamido-5-(2-trimethylsilylethynyl)phenyl]ethynyl]-4-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2-[2-[2-acetamido-5-(2-trimethylsilylethynyl)phenyl]ethynyl]-4-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 101224817 |
| Molecular Formula | C28H31NO3Si2 |
| Molecular Weight | 485.73 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | methyl 2-[2-[2-acetamido-5-(2-trimethylsilylethynyl)phenyl]ethynyl]-4-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1ccc(C#C[Si](C)(C)C)cc1C#Cc1cc(C#C[Si](C)(C)C)ccc1NC(C)=O |
| InChI | InChI=1S/C28H31NO3Si2/c1-21(30)29-27-14-10-23(16-18-34(6,7)8)20-25(27)12-11-24-19-22(15-17-33(3,4)5)9-13-26(24)28(31)32-2/h9-10,13-14,19-20H,1-8H3,(H,29,30) |
| InChIKey | ZDIUIWWKPOOWCW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|