C13H14F2O2Si — CID 140966195
methyl 2,6-difluoro-4-(2-trimethylsilylethynyl)benzoate (PubChem CID 140966195) has the molecular formula C13H14F2O2Si and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 2,6-difluoro-4-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2,6-difluoro-4-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 140966195 |
| Molecular Formula | C13H14F2O2Si |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | methyl 2,6-difluoro-4-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1c(F)cc(C#C[Si](C)(C)C)cc1F |
| InChI | InChI=1S/C13H14F2O2Si/c1-17-13(16)12-10(14)7-9(8-11(12)15)5-6-18(2,3)4/h7-8H,1-4H3 |
| InChIKey | WCNBARSFJJVYGK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|