C15H20O4Si — CID 11197116
methyl 2,3-dimethoxy-6-(2-trimethylsilylethynyl)benzoate (PubChem CID 11197116) has the molecular formula C15H20O4Si and a molecular weight of 292.41 g/mol. Its IUPAC name is methyl 2,3-dimethoxy-6-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2,3-dimethoxy-6-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 11197116 |
| Molecular Formula | C15H20O4Si |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 2,3-dimethoxy-6-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1c(C#C[Si](C)(C)C)ccc(OC)c1OC |
| InChI | InChI=1S/C15H20O4Si/c1-17-12-8-7-11(9-10-20(4,5)6)13(14(12)18-2)15(16)19-3/h7-8H,1-6H3 |
| InChIKey | DIXZQVIRWVVRFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|