C27H25F2NO4Si — CID 175362557
3,6-difluoro-2-[[2-methoxycarbonyl-4-(2-trimethylsilylethynyl)phenyl]methylamino]-4-phenylbenzoic acid (PubChem CID 175362557) has the molecular formula C27H25F2NO4Si and a molecular weight of 493.58 g/mol. Its IUPAC name is 3,6-difluoro-2-[[2-methoxycarbonyl-4-(2-trimethylsilylethynyl)phenyl]methylamino]-4-phenylbenzoic acid.
| Compound Name | 3,6-difluoro-2-[[2-methoxycarbonyl-4-(2-trimethylsilylethynyl)phenyl]methylamino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 175362557 |
| Molecular Formula | C27H25F2NO4Si |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3,6-difluoro-2-[[2-methoxycarbonyl-4-(2-trimethylsilylethynyl)phenyl]methylamino]-4-phenylbenzoic acid |
| SMILES | COC(=O)c1cc(C#C[Si](C)(C)C)ccc1CNc1c(F)c(-c2ccccc2)cc(F)c1C(=O)O |
| InChI | InChI=1S/C27H25F2NO4Si/c1-34-27(33)21-14-17(12-13-35(2,3)4)10-11-19(21)16-30-25-23(26(31)32)22(28)15-20(24(25)29)18-8-6-5-7-9-18/h5-11,14-15,30H,16H2,1-4H3,(H,31,32) |
| InChIKey | VNHFBDXAEFAEKB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|