C27H33N3O2Si — CID 22456498
methyl 2-[2-[4-[[di(propan-2-yl)amino]diazenyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate (PubChem CID 22456498) has the molecular formula C27H33N3O2Si and a molecular weight of 459.67 g/mol. Its IUPAC name is methyl 2-[2-[4-[[di(propan-2-yl)amino]diazenyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2-[2-[4-[[di(propan-2-yl)amino]diazenyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 22456498 |
| Molecular Formula | C27H33N3O2Si |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | methyl 2-[2-[4-[[di(propan-2-yl)amino]diazenyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1cc(C#C[Si](C)(C)C)ccc1C#Cc1ccc(/N=N/N(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O2Si/c1-20(2)30(21(3)4)29-28-25-15-11-22(12-16-25)9-13-24-14-10-23(17-18-33(6,7)8)19-26(24)27(31)32-5/h10-12,14-16,19-21H,1-8H3/b29-28+ |
| InChIKey | RZLHRBSEVIRSAS-ZQHSETAFSA-N |
| XLogP | 6.22 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|