About methyl 2-fluoro-4,6-diiodobenzoate
methyl 2-fluoro-4,6-diiodobenzoate (PubChem CID 130766583) has the molecular formula C8H5FI2O2
and a molecular weight of 405.93 g/mol. Its IUPAC name is methyl 2-fluoro-4,6-diiodobenzoate.
Molecular Properties
| Compound Name | methyl 2-fluoro-4,6-diiodobenzoate |
| PubChem CID | 130766583 |
| Molecular Formula | C8H5FI2O2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.84 |
| IUPAC Name | methyl 2-fluoro-4,6-diiodobenzoate |
| SMILES | COC(=O)c1c(F)cc(I)cc1I |
| InChI | InChI=1S/C8H5FI2O2/c1-13-8(12)7-5(9)2-4(10)3-6(7)11/h2-3H,1H3 |
| InChIKey | DSSQDQPFXDKCBH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-fluoro-4,6-diiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-4,6-diiodobenzoate?
The IUPAC name of methyl 2-fluoro-4,6-diiodobenzoate (CID 130766583) is methyl 2-fluoro-4,6-diiodobenzoate.
What is the SMILES notation for methyl 2-fluoro-4,6-diiodobenzoate?
The canonical SMILES for methyl 2-fluoro-4,6-diiodobenzoate is COC(=O)c1c(F)cc(I)cc1I.
What is the InChIKey of methyl 2-fluoro-4,6-diiodobenzoate?
The InChIKey is DSSQDQPFXDKCBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FI2O2/c1-13-8(12)7-5(9)2-4(10)3-6(7)11/h2-3H,1H3.
What are the key properties of methyl 2-fluoro-4,6-diiodobenzoate?
methyl 2-fluoro-4,6-diiodobenzoate has a molecular weight of 405.93 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-4,6-diiodobenzoate is sourced from PubChem (CID 130766583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).