C15H18ClNO4Si — CID 19379151
methyl 4-acetamido-5-chloro-2-hydroxy-3-(2-trimethylsilylethynyl)benzoate (PubChem CID 19379151) has the molecular formula C15H18ClNO4Si and a molecular weight of 339.85 g/mol. Its IUPAC name is methyl 4-acetamido-5-chloro-2-hydroxy-3-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 4-acetamido-5-chloro-2-hydroxy-3-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 19379151 |
| Molecular Formula | C15H18ClNO4Si |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | methyl 4-acetamido-5-chloro-2-hydroxy-3-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(C)=O)c(C#C[Si](C)(C)C)c1O |
| InChI | InChI=1S/C15H18ClNO4Si/c1-9(18)17-13-10(6-7-22(3,4)5)14(19)11(8-12(13)16)15(20)21-2/h8,19H,1-5H3,(H,17,18) |
| InChIKey | BOXUQHCDOCJGMS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|