C22H20Br2Cl2N2O8 — CID 76847760
methyl 4-acetamido-2-[2-(3-acetamido-2-bromo-4-chloro-6-methoxycarbonylphenoxy)ethoxy]-3-bromo-5-chlorobenzoate (PubChem CID 76847760) has the molecular formula C22H20Br2Cl2N2O8 and a molecular weight of 671.12 g/mol. Its IUPAC name is methyl 4-acetamido-2-[2-(3-acetamido-2-bromo-4-chloro-6-methoxycarbonylphenoxy)ethoxy]-3-bromo-5-chlorobenzoate.
| Compound Name | methyl 4-acetamido-2-[2-(3-acetamido-2-bromo-4-chloro-6-methoxycarbonylphenoxy)ethoxy]-3-bromo-5-chlorobenzoate |
|---|---|
| PubChem CID | 76847760 |
| Molecular Formula | C22H20Br2Cl2N2O8 |
| Molecular Weight | 671.12 g/mol |
| Exact Mass | 667.90 |
| IUPAC Name | methyl 4-acetamido-2-[2-(3-acetamido-2-bromo-4-chloro-6-methoxycarbonylphenoxy)ethoxy]-3-bromo-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(C)=O)c(Br)c1OCCOc1c(C(=O)OC)cc(Cl)c(NC(C)=O)c1Br |
| InChI | InChI=1S/C22H20Br2Cl2N2O8/c1-9(29)27-17-13(25)7-11(21(31)33-3)19(15(17)23)35-5-6-36-20-12(22(32)34-4)8-14(26)18(16(20)24)28-10(2)30/h7-8H,5-6H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | AJNQFSUHNFGYHX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|