C12H10ClNO4 — CID 11108337
methyl 4-acetamido-5-chloro-1-benzofuran-7-carboxylate (PubChem CID 11108337) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is methyl 4-acetamido-5-chloro-1-benzofuran-7-carboxylate.
| Compound Name | methyl 4-acetamido-5-chloro-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 11108337 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | methyl 4-acetamido-5-chloro-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c(NC(C)=O)c2ccoc12 |
| InChI | InChI=1S/C12H10ClNO4/c1-6(15)14-10-7-3-4-18-11(7)8(5-9(10)13)12(16)17-2/h3-5H,1-2H3,(H,14,15) |
| InChIKey | FSBBKKVSKGIHRY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |