About methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate
methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate (PubChem CID 132564114) has the molecular formula C21H22Br2O8
and a molecular weight of 562.21 g/mol. Its IUPAC name is methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate |
| PubChem CID | 132564114 |
| Molecular Formula | C21H22Br2O8 |
| Molecular Weight | 562.21 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(Cc2cc(C(=O)OC)c(OC)c(OC)c2Br)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C21H22Br2O8/c1-26-16-12(20(24)30-5)8-10(14(22)18(16)28-3)7-11-9-13(21(25)31-6)17(27-2)19(29-4)15(11)23/h8-9H,7H2,1-6H3 |
| InChIKey | FKRPKYDQPAGNCK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 562.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate?
The IUPAC name of methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate (CID 132564114) is methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate.
What is the SMILES notation for methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate?
The canonical SMILES for methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate is COC(=O)c1cc(Cc2cc(C(=O)OC)c(OC)c(OC)c2Br)c(Br)c(OC)c1OC.
What is the InChIKey of methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate?
The InChIKey is FKRPKYDQPAGNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Br2O8/c1-26-16-12(20(24)30-5)8-10(14(22)18(16)28-3)7-11-9-13(21(25)31-6)17(27-2)19(29-4)15(11)23/h8-9H,7H2,1-6H3.
What are the key properties of methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate?
methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate has a molecular weight of 562.21 g/mol, XLogP of 4.41, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-5-[(2-bromo-3,4-dimethoxy-5-methoxycarbonylphenyl)methyl]-2,3-dimethoxybenzoate is sourced from PubChem (CID 132564114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).