C9H5Cl2O4- — CID 71345963
4,5-dichloro-2-methoxycarbonylbenzoate (PubChem CID 71345963) has the molecular formula C9H5Cl2O4- and a molecular weight of 248.04 g/mol. Its IUPAC name is 4,5-dichloro-2-methoxycarbonylbenzoate.
| Compound Name | 4,5-dichloro-2-methoxycarbonylbenzoate |
|---|---|
| PubChem CID | 71345963 |
| Molecular Formula | C9H5Cl2O4- |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 4,5-dichloro-2-methoxycarbonylbenzoate |
| SMILES | COC(=O)c1cc(Cl)c(Cl)cc1C(=O)[O-] |
| InChI | InChI=1S/C9H6Cl2O4/c1-15-9(14)5-3-7(11)6(10)2-4(5)8(12)13/h2-3H,1H3,(H,12,13)/p-1 |
| InChIKey | ZKGKTIKTGHPAFM-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |