C14H16F3NO4SSi — CID 135051784
[4-acetamido-3-(2-trimethylsilylethynyl)phenyl] trifluoromethanesulfonate (PubChem CID 135051784) has the molecular formula C14H16F3NO4SSi and a molecular weight of 379.43 g/mol. Its IUPAC name is [4-acetamido-3-(2-trimethylsilylethynyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-acetamido-3-(2-trimethylsilylethynyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135051784 |
| Molecular Formula | C14H16F3NO4SSi |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [4-acetamido-3-(2-trimethylsilylethynyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)C(F)(F)F)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H16F3NO4SSi/c1-10(19)18-13-6-5-12(22-23(20,21)14(15,16)17)9-11(13)7-8-24(2,3)4/h5-6,9H,1-4H3,(H,18,19) |
| InChIKey | KBNORDDFBITIEJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|