C25H26Cl2N2O5Si — CID 160708554
N-[5-chloro-4-(2-hydroxyacetyl)-2-(2-trimethylsilylethynyl)phenyl]acetamide;1-(6-chloro-1H-indol-5-yl)-2-hydroxyethanone (PubChem CID 160708554) has the molecular formula C25H26Cl2N2O5Si and a molecular weight of 533.48 g/mol. Its IUPAC name is N-[5-chloro-4-(2-hydroxyacetyl)-2-(2-trimethylsilylethynyl)phenyl]acetamide;1-(6-chloro-1H-indol-5-yl)-2-hydroxyethanone.
| Compound Name | N-[5-chloro-4-(2-hydroxyacetyl)-2-(2-trimethylsilylethynyl)phenyl]acetamide;1-(6-chloro-1H-indol-5-yl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 160708554 |
| Molecular Formula | C25H26Cl2N2O5Si |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | N-[5-chloro-4-(2-hydroxyacetyl)-2-(2-trimethylsilylethynyl)phenyl]acetamide;1-(6-chloro-1H-indol-5-yl)-2-hydroxyethanone |
| SMILES | CC(=O)Nc1cc(Cl)c(C(=O)CO)cc1C#C[Si](C)(C)C.O=C(CO)c1cc2cc[nH]c2cc1Cl |
| InChI | InChI=1S/C15H18ClNO3Si.C10H8ClNO2/c1-10(19)17-14-8-13(16)12(15(20)9-18)7-11(14)5-6-21(2,3)4;11-8-4-9-6(1-2-12-9)3-7(8)10(14)5-13/h7-8,18H,9H2,1-4H3,(H,17,19);1-4,12-13H,5H2 |
| InChIKey | RRNWCOKWTGYZJR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|