C19H17F3O4SSi — CID 10788559
[4-[3-(2-trimethylsilylethynyl)benzoyl]phenyl] trifluoromethanesulfonate (PubChem CID 10788559) has the molecular formula C19H17F3O4SSi and a molecular weight of 426.49 g/mol. Its IUPAC name is [4-[3-(2-trimethylsilylethynyl)benzoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3-(2-trimethylsilylethynyl)benzoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10788559 |
| Molecular Formula | C19H17F3O4SSi |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [4-[3-(2-trimethylsilylethynyl)benzoyl]phenyl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)C#Cc1cccc(C(=O)c2ccc(OS(=O)(=O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H17F3O4SSi/c1-28(2,3)12-11-14-5-4-6-16(13-14)18(23)15-7-9-17(10-8-15)26-27(24,25)19(20,21)22/h4-10,13H,1-3H3 |
| InChIKey | FNJNHVHWUNKTHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|