C21H10F4O — CID 70116855
(4-fluorophenyl)-[3-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]methanone (PubChem CID 70116855) has the molecular formula C21H10F4O and a molecular weight of 354.30 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]methanone.
| Compound Name | (4-fluorophenyl)-[3-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]methanone |
|---|---|
| PubChem CID | 70116855 |
| Molecular Formula | C21H10F4O |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (4-fluorophenyl)-[3-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]methanone |
| SMILES | O=C(c1ccc(F)cc1)c1cccc(C#Cc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C21H10F4O/c22-17-8-6-15(7-9-17)21(26)16-3-1-2-13(10-16)4-5-14-11-18(23)20(25)19(24)12-14/h1-3,6-12H |
| InChIKey | QZDZEBPCPHOMHM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|