About (2-buta-1,3-diynyl-4-tert-butylphenyl)urea
(2-buta-1,3-diynyl-4-tert-butylphenyl)urea (PubChem CID 162406403) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is (2-buta-1,3-diynyl-4-tert-butylphenyl)urea.
Molecular Properties
| Compound Name | (2-buta-1,3-diynyl-4-tert-butylphenyl)urea |
| PubChem CID | 162406403 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2-buta-1,3-diynyl-4-tert-butylphenyl)urea |
| SMILES | C#CC#Cc1cc(C(C)(C)C)ccc1NC(N)=O |
| InChI | InChI=1S/C15H16N2O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)17-14(16)18/h1,8-10H,2-4H3,(H3,16,17,18) |
| InChIKey | IGCBYJZSYIAFNR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-buta-1,3-diynyl-4-tert-butylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-buta-1,3-diynyl-4-tert-butylphenyl)urea?
The IUPAC name of (2-buta-1,3-diynyl-4-tert-butylphenyl)urea (CID 162406403) is (2-buta-1,3-diynyl-4-tert-butylphenyl)urea.
What is the SMILES notation for (2-buta-1,3-diynyl-4-tert-butylphenyl)urea?
The canonical SMILES for (2-buta-1,3-diynyl-4-tert-butylphenyl)urea is C#CC#Cc1cc(C(C)(C)C)ccc1NC(N)=O.
What is the InChIKey of (2-buta-1,3-diynyl-4-tert-butylphenyl)urea?
The InChIKey is IGCBYJZSYIAFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)17-14(16)18/h1,8-10H,2-4H3,(H3,16,17,18).
What are the key properties of (2-buta-1,3-diynyl-4-tert-butylphenyl)urea?
(2-buta-1,3-diynyl-4-tert-butylphenyl)urea has a molecular weight of 240.31 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-buta-1,3-diynyl-4-tert-butylphenyl)urea is sourced from PubChem (CID 162406403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).