C15H16N2O — CID 162406403
(2-buta-1,3-diynyl-4-tert-butylphenyl)urea (PubChem CID 162406403) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (2-buta-1,3-diynyl-4-tert-butylphenyl)urea.
| Compound Name | (2-buta-1,3-diynyl-4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 162406403 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2-buta-1,3-diynyl-4-tert-butylphenyl)urea |
| SMILES | C#CC#Cc1cc(C(C)(C)C)ccc1NC(N)=O |
| InChI | InChI=1S/C15H16N2O/c1-5-6-7-11-10-12(15(2,3)4)8-9-13(11)17-14(16)18/h1,8-10H,2-4H3,(H3,16,17,18) |
| InChIKey | IGCBYJZSYIAFNR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|