C12H10N2O — CID 121011481
1-(2-buta-1,3-diynylphenyl)-3-methylurea (PubChem CID 121011481) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(2-buta-1,3-diynylphenyl)-3-methylurea.
| Compound Name | 1-(2-buta-1,3-diynylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 121011481 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(2-buta-1,3-diynylphenyl)-3-methylurea |
| SMILES | C#CC#Cc1ccccc1NC(=O)NC |
| InChI | InChI=1S/C12H10N2O/c1-3-4-7-10-8-5-6-9-11(10)14-12(15)13-2/h1,5-6,8-9H,2H3,(H2,13,14,15) |
| InChIKey | MDEPUCFFVYZTOY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|