C25H25NOSi — CID 10738761
2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]acetamide (PubChem CID 10738761) has the molecular formula C25H25NOSi and a molecular weight of 383.57 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 10738761 |
| Molecular Formula | C25H25NOSi |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]acetamide |
| SMILES | C[Si](C)(C)C#Cc1ccccc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NOSi/c1-28(2,3)19-18-20-12-10-11-17-23(20)26-25(27)24(21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-17,24H,1-3H3,(H,26,27) |
| InChIKey | PQNGJDMTPGILCB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|