C25H26N2O2 — CID 1369721
2-[(2,2-diphenylacetyl)amino]-N-(2-methylpropyl)benzamide (PubChem CID 1369721) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 1369721 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccccc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c1-18(2)17-26-24(28)21-15-9-10-16-22(21)27-25(29)23(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18,23H,17H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | JAUGEEAFWVPZQA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |