C28H24N2O3 — CID 990917
2-[(2,2-diphenylacetyl)amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 990917) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 990917 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccccc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O3/c1-33-25-19-11-10-18-24(25)30-27(31)22-16-8-9-17-23(22)29-28(32)26(20-12-4-2-5-13-20)21-14-6-3-7-15-21/h2-19,26H,1H3,(H,29,32)(H,30,31) |
| InChIKey | GARKZPAWNWMNMV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |