C14H15BrN4O2 — CID 113050137
ethyl N-[6-(2-bromo-4-methylanilino)pyridazin-3-yl]carbamate (PubChem CID 113050137) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is ethyl N-[6-(2-bromo-4-methylanilino)pyridazin-3-yl]carbamate.
| Compound Name | ethyl N-[6-(2-bromo-4-methylanilino)pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113050137 |
| Molecular Formula | C14H15BrN4O2 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | ethyl N-[6-(2-bromo-4-methylanilino)pyridazin-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccc(C)cc2Br)nn1 |
| InChI | InChI=1S/C14H15BrN4O2/c1-3-21-14(20)17-13-7-6-12(18-19-13)16-11-5-4-9(2)8-10(11)15/h4-8H,3H2,1-2H3,(H,16,18)(H,17,19,20) |
| InChIKey | VWHCWLRKZKFXBX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |