C16H20N4O — CID 113046269
N-[6-(2,5-dimethylanilino)pyridazin-3-yl]butanamide (PubChem CID 113046269) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[6-(2,5-dimethylanilino)pyridazin-3-yl]butanamide.
| Compound Name | N-[6-(2,5-dimethylanilino)pyridazin-3-yl]butanamide |
|---|---|
| PubChem CID | 113046269 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[6-(2,5-dimethylanilino)pyridazin-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2cc(C)ccc2C)nn1 |
| InChI | InChI=1S/C16H20N4O/c1-4-5-16(21)18-15-9-8-14(19-20-15)17-13-10-11(2)6-7-12(13)3/h6-10H,4-5H2,1-3H3,(H,17,19)(H,18,20,21) |
| InChIKey | CWBOYTOWVCCMRO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |