C7H5ClFNO2 — CID 142574349
3-chloro-5-fluoro-6-methylpyridine-2-carboxylic acid (PubChem CID 142574349) has the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. Its IUPAC name is 3-chloro-5-fluoro-6-methylpyridine-2-carboxylic acid.
| Compound Name | 3-chloro-5-fluoro-6-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 142574349 |
| Molecular Formula | C7H5ClFNO2 |
| Molecular Weight | 189.57 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | 3-chloro-5-fluoro-6-methylpyridine-2-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(Cl)cc1F |
| InChI | InChI=1S/C7H5ClFNO2/c1-3-5(9)2-4(8)6(10-3)7(11)12/h2H,1H3,(H,11,12) |
| InChIKey | ZCZVHJUCWBBHQT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |