C9H10FNO — CID 144835745
1-(5-fluoro-2,6-dimethyl-3-pyridinyl)ethanone (PubChem CID 144835745) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 1-(5-fluoro-2,6-dimethyl-3-pyridinyl)ethanone.
| Compound Name | 1-(5-fluoro-2,6-dimethyl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 144835745 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-(5-fluoro-2,6-dimethyl-3-pyridinyl)ethanone |
| SMILES | CC(=O)c1cc(F)c(C)nc1C |
| InChI | InChI=1S/C9H10FNO/c1-5-8(7(3)12)4-9(10)6(2)11-5/h4H,1-3H3 |
| InChIKey | WTZDXDIYFPXUSF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |