C9H7F3O — CID 20552321
1-(3,4,5-trifluoro-2-methylphenyl)ethanone (PubChem CID 20552321) has the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. Its IUPAC name is 1-(3,4,5-trifluoro-2-methylphenyl)ethanone.
| Compound Name | 1-(3,4,5-trifluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 20552321 |
| Molecular Formula | C9H7F3O |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1-(3,4,5-trifluoro-2-methylphenyl)ethanone |
| SMILES | CC(=O)c1cc(F)c(F)c(F)c1C |
| InChI | InChI=1S/C9H7F3O/c1-4-6(5(2)13)3-7(10)9(12)8(4)11/h3H,1-2H3 |
| InChIKey | IOUVKZAOESSJDH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|