C14H13F3O3 — CID 173250806
ethyl 4-oxo-3-(3,4,5-trifluoro-2-methylphenyl)pent-2-enoate (PubChem CID 173250806) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is ethyl 4-oxo-3-(3,4,5-trifluoro-2-methylphenyl)pent-2-enoate.
| Compound Name | ethyl 4-oxo-3-(3,4,5-trifluoro-2-methylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 173250806 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | ethyl 4-oxo-3-(3,4,5-trifluoro-2-methylphenyl)pent-2-enoate |
| SMILES | CCOC(=O)C=C(C(C)=O)c1cc(F)c(F)c(F)c1C |
| InChI | InChI=1S/C14H13F3O3/c1-4-20-12(19)6-10(8(3)18)9-5-11(15)14(17)13(16)7(9)2/h5-6H,4H2,1-3H3 |
| InChIKey | PYEPFGGVNVRBAU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|