C9H4F6O — CID 21122127
1-[2,4,5-trifluoro-3-(trifluoromethyl)phenyl]ethanone (PubChem CID 21122127) has the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. Its IUPAC name is 1-[2,4,5-trifluoro-3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2,4,5-trifluoro-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 21122127 |
| Molecular Formula | C9H4F6O |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 1-[2,4,5-trifluoro-3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(F)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C9H4F6O/c1-3(16)4-2-5(10)8(12)6(7(4)11)9(13,14)15/h2H,1H3 |
| InChIKey | QCLCZQPXGQLXCD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|