C13H13ClN2O2 — CID 59894472
methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate (PubChem CID 59894472) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate.
| Compound Name | methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 59894472 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate |
| SMILES | COC(=O)c1c(C)c(C)cc2nc(C)c(Cl)nc12 |
| InChI | InChI=1S/C13H13ClN2O2/c1-6-5-9-11(16-12(14)8(3)15-9)10(7(6)2)13(17)18-4/h5H,1-4H3 |
| InChIKey | PGPARAVSKKHMDK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |