methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate

C13H13ClN2O2 — CID 59894472

IUPACmethyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate
SMILESCOC(=O)c1c(C)c(C)cc2nc(C)c(Cl)nc12
InChIInChI=1S/C13H13ClN2O2/c1-6-5-9-11(16-12(14)8(3)15-9)10(7(6)2)13(17)18-4/h5H,1-4H3
InChIKeyPGPARAVSKKHMDK-UHFFFAOYSA-N
MW264.71 g/mol
LogP3.00
Rot. Bonds1

About methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate

methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate (PubChem CID 59894472) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate.

Molecular Properties

Compound Namemethyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate
PubChem CID59894472
Molecular FormulaC13H13ClN2O2
Molecular Weight264.71 g/mol
Exact Mass264.07
IUPAC Namemethyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate
SMILESCOC(=O)c1c(C)c(C)cc2nc(C)c(Cl)nc12
InChIInChI=1S/C13H13ClN2O2/c1-6-5-9-11(16-12(14)8(3)15-9)10(7(6)2)13(17)18-4/h5H,1-4H3
InChIKeyPGPARAVSKKHMDK-UHFFFAOYSA-N
XLogP3.00
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.71
LogP ≤ 53.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate?
The IUPAC name of methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate (CID 59894472) is methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate.
What is the SMILES notation for methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate?
The canonical SMILES for methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate is COC(=O)c1c(C)c(C)cc2nc(C)c(Cl)nc12.
What is the InChIKey of methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate?
The InChIKey is PGPARAVSKKHMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O2/c1-6-5-9-11(16-12(14)8(3)15-9)10(7(6)2)13(17)18-4/h5H,1-4H3.
What are the key properties of methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate?
methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate has a molecular weight of 264.71 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-2,6,7-trimethylquinoxaline-5-carboxylate is sourced from PubChem (CID 59894472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).